C20H21FN2O3 — CID 175334673
N-(2,5-dihydroxypentyl)-5-(4-fluorophenyl)-1H-indole-2-carboxamide (PubChem CID 175334673) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is N-(2,5-dihydroxypentyl)-5-(4-fluorophenyl)-1H-indole-2-carboxamide.
| Compound Name | N-(2,5-dihydroxypentyl)-5-(4-fluorophenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 175334673 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N-(2,5-dihydroxypentyl)-5-(4-fluorophenyl)-1H-indole-2-carboxamide |
| SMILES | O=C(NCC(O)CCCO)c1cc2cc(-c3ccc(F)cc3)ccc2[nH]1 |
| InChI | InChI=1S/C20H21FN2O3/c21-16-6-3-13(4-7-16)14-5-8-18-15(10-14)11-19(23-18)20(26)22-12-17(25)2-1-9-24/h3-8,10-11,17,23-25H,1-2,9,12H2,(H,22,26) |
| InChIKey | LFBRJEULAQJAAW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |