C17H23FN2O2 — CID 109380589
5-fluoro-N-(3-hydroxy-2,2,4-trimethylpentyl)-1H-indole-2-carboxamide (PubChem CID 109380589) has the molecular formula C17H23FN2O2 and a molecular weight of 306.38 g/mol. Its IUPAC name is 5-fluoro-N-(3-hydroxy-2,2,4-trimethylpentyl)-1H-indole-2-carboxamide.
| Compound Name | 5-fluoro-N-(3-hydroxy-2,2,4-trimethylpentyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 109380589 |
| Molecular Formula | C17H23FN2O2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 5-fluoro-N-(3-hydroxy-2,2,4-trimethylpentyl)-1H-indole-2-carboxamide |
| SMILES | CC(C)C(O)C(C)(C)CNC(=O)c1cc2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C17H23FN2O2/c1-10(2)15(21)17(3,4)9-19-16(22)14-8-11-7-12(18)5-6-13(11)20-14/h5-8,10,15,20-21H,9H2,1-4H3,(H,19,22) |
| InChIKey | GMHOMQJVWRTSDI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |