C19H27FN2O2 — CID 109380737
2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-(3-hydroxy-2,2,4-trimethylpentyl)acetamide (PubChem CID 109380737) has the molecular formula C19H27FN2O2 and a molecular weight of 334.44 g/mol. Its IUPAC name is 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-(3-hydroxy-2,2,4-trimethylpentyl)acetamide.
| Compound Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-(3-hydroxy-2,2,4-trimethylpentyl)acetamide |
|---|---|
| PubChem CID | 109380737 |
| Molecular Formula | C19H27FN2O2 |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-(3-hydroxy-2,2,4-trimethylpentyl)acetamide |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)NCC(C)(C)C(O)C(C)C |
| InChI | InChI=1S/C19H27FN2O2/c1-11(2)18(24)19(4,5)10-21-17(23)9-14-12(3)22-16-7-6-13(20)8-15(14)16/h6-8,11,18,22,24H,9-10H2,1-5H3,(H,21,23) |
| InChIKey | UUBHXHFOVIJDMU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|