C16H24FNO3 — CID 109380791
2-(4-fluorophenoxy)-N-(3-hydroxy-2,2,4-trimethylpentyl)acetamide (PubChem CID 109380791) has the molecular formula C16H24FNO3 and a molecular weight of 297.37 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-(3-hydroxy-2,2,4-trimethylpentyl)acetamide.
| Compound Name | 2-(4-fluorophenoxy)-N-(3-hydroxy-2,2,4-trimethylpentyl)acetamide |
|---|---|
| PubChem CID | 109380791 |
| Molecular Formula | C16H24FNO3 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-(3-hydroxy-2,2,4-trimethylpentyl)acetamide |
| SMILES | CC(C)C(O)C(C)(C)CNC(=O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C16H24FNO3/c1-11(2)15(20)16(3,4)10-18-14(19)9-21-13-7-5-12(17)6-8-13/h5-8,11,15,20H,9-10H2,1-4H3,(H,18,19) |
| InChIKey | TWEDNYLWPMYXEE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |