C20H25FN2O — CID 144936015
N-benzyl-5-fluoro-1H-indole-2-carboxamide;ethane (PubChem CID 144936015) has the molecular formula C20H25FN2O and a molecular weight of 328.43 g/mol. Its IUPAC name is N-benzyl-5-fluoro-1H-indole-2-carboxamide;ethane.
| Compound Name | N-benzyl-5-fluoro-1H-indole-2-carboxamide;ethane |
|---|---|
| PubChem CID | 144936015 |
| Molecular Formula | C20H25FN2O |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | N-benzyl-5-fluoro-1H-indole-2-carboxamide;ethane |
| SMILES | CC.CC.O=C(NCc1ccccc1)c1cc2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C16H13FN2O.2C2H6/c17-13-6-7-14-12(8-13)9-15(19-14)16(20)18-10-11-4-2-1-3-5-11;2*1-2/h1-9,19H,10H2,(H,18,20);2*1-2H3 |
| InChIKey | MGRAYDDARCYHBX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |