C19H19FN2O — CID 39982788
5-fluoro-N-[(2R)-4-phenylbutan-2-yl]-1H-indole-2-carboxamide (PubChem CID 39982788) has the molecular formula C19H19FN2O and a molecular weight of 310.37 g/mol. Its IUPAC name is 5-fluoro-N-[(2R)-4-phenylbutan-2-yl]-1H-indole-2-carboxamide.
| Compound Name | 5-fluoro-N-[(2R)-4-phenylbutan-2-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 39982788 |
| Molecular Formula | C19H19FN2O |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 5-fluoro-N-[(2R)-4-phenylbutan-2-yl]-1H-indole-2-carboxamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)c1cc2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C19H19FN2O/c1-13(7-8-14-5-3-2-4-6-14)21-19(23)18-12-15-11-16(20)9-10-17(15)22-18/h2-6,9-13,22H,7-8H2,1H3,(H,21,23)/t13-/m1/s1 |
| InChIKey | NEGSXSGOEFJMOV-CYBMUJFWSA-N |
| XLogP | 4.06 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |