C20H22N2O — CID 7322431
5-methyl-N-[(2S)-4-phenylbutan-2-yl]-1H-indole-2-carboxamide (PubChem CID 7322431) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 5-methyl-N-[(2S)-4-phenylbutan-2-yl]-1H-indole-2-carboxamide.
| Compound Name | 5-methyl-N-[(2S)-4-phenylbutan-2-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 7322431 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 5-methyl-N-[(2S)-4-phenylbutan-2-yl]-1H-indole-2-carboxamide |
| SMILES | Cc1ccc2[nH]c(C(=O)N[C@@H](C)CCc3ccccc3)cc2c1 |
| InChI | InChI=1S/C20H22N2O/c1-14-8-11-18-17(12-14)13-19(22-18)20(23)21-15(2)9-10-16-6-4-3-5-7-16/h3-8,11-13,15,22H,9-10H2,1-2H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | NZXYBJPKEQLGOB-HNNXBMFYSA-N |
| XLogP | 4.23 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |