C18H17FN2OS — CID 38572594
5-fluoro-N-(3-phenylsulfanylpropyl)-1H-indole-2-carboxamide (PubChem CID 38572594) has the molecular formula C18H17FN2OS and a molecular weight of 328.41 g/mol. Its IUPAC name is 5-fluoro-N-(3-phenylsulfanylpropyl)-1H-indole-2-carboxamide.
| Compound Name | 5-fluoro-N-(3-phenylsulfanylpropyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 38572594 |
| Molecular Formula | C18H17FN2OS |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 5-fluoro-N-(3-phenylsulfanylpropyl)-1H-indole-2-carboxamide |
| SMILES | O=C(NCCCSc1ccccc1)c1cc2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C18H17FN2OS/c19-14-7-8-16-13(11-14)12-17(21-16)18(22)20-9-4-10-23-15-5-2-1-3-6-15/h1-3,5-8,11-12,21H,4,9-10H2,(H,20,22) |
| InChIKey | COZZMFPPBAVRIP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|