C17H17FN2O2S — CID 30860863
4-N-[3-(4-fluorophenyl)sulfanylpropyl]benzene-1,4-dicarboxamide (PubChem CID 30860863) has the molecular formula C17H17FN2O2S and a molecular weight of 332.40 g/mol. Its IUPAC name is 4-N-[3-(4-fluorophenyl)sulfanylpropyl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[3-(4-fluorophenyl)sulfanylpropyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 30860863 |
| Molecular Formula | C17H17FN2O2S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 4-N-[3-(4-fluorophenyl)sulfanylpropyl]benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(=O)NCCCSc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H17FN2O2S/c18-14-6-8-15(9-7-14)23-11-1-10-20-17(22)13-4-2-12(3-5-13)16(19)21/h2-9H,1,10-11H2,(H2,19,21)(H,20,22) |
| InChIKey | YOBBPMHNNLYJKL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|