C11H15N3O2 — CID 11053215
4-N-(3-aminopropyl)benzene-1,4-dicarboxamide (PubChem CID 11053215) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 4-N-(3-aminopropyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(3-aminopropyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 11053215 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 4-N-(3-aminopropyl)benzene-1,4-dicarboxamide |
| SMILES | NCCCNC(=O)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C11H15N3O2/c12-6-1-7-14-11(16)9-4-2-8(3-5-9)10(13)15/h2-5H,1,6-7,12H2,(H2,13,15)(H,14,16) |
| InChIKey | UJJYXRJHJBSKMQ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|