C21H30N2O3 — CID 143035952
ethane;N-(3-hydroxypropyl)-4-methylbenzamide;4-methylbenzamide (PubChem CID 143035952) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is ethane;N-(3-hydroxypropyl)-4-methylbenzamide;4-methylbenzamide.
| Compound Name | ethane;N-(3-hydroxypropyl)-4-methylbenzamide;4-methylbenzamide |
|---|---|
| PubChem CID | 143035952 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | ethane;N-(3-hydroxypropyl)-4-methylbenzamide;4-methylbenzamide |
| SMILES | CC.Cc1ccc(C(=O)NCCCO)cc1.Cc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C11H15NO2.C8H9NO.C2H6/c1-9-3-5-10(6-4-9)11(14)12-7-2-8-13;1-6-2-4-7(5-3-6)8(9)10;1-2/h3-6,13H,2,7-8H2,1H3,(H,12,14);2-5H,1H3,(H2,9,10);1-2H3 |
| InChIKey | USEFKSXFEBTHEE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|