C25H31N3O5 — CID 58936752
ethyl 4-[7-[(4-carbamoylbenzoyl)amino]heptylcarbamoyl]benzoate (PubChem CID 58936752) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is ethyl 4-[7-[(4-carbamoylbenzoyl)amino]heptylcarbamoyl]benzoate.
| Compound Name | ethyl 4-[7-[(4-carbamoylbenzoyl)amino]heptylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 58936752 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | ethyl 4-[7-[(4-carbamoylbenzoyl)amino]heptylcarbamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C(=O)NCCCCCCCNC(=O)c2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C25H31N3O5/c1-2-33-25(32)21-14-12-20(13-15-21)24(31)28-17-7-5-3-4-6-16-27-23(30)19-10-8-18(9-11-19)22(26)29/h8-15H,2-7,16-17H2,1H3,(H2,26,29)(H,27,30)(H,28,31) |
| InChIKey | JHRISDQDGCJGKY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|