C20H37N5O2 — CID 101205073
N-[3-[4-[3-(3-aminopropylamino)propylamino]butylamino]propyl]-4-hydroxybenzamide (PubChem CID 101205073) has the molecular formula C20H37N5O2 and a molecular weight of 379.55 g/mol. Its IUPAC name is N-[3-[4-[3-(3-aminopropylamino)propylamino]butylamino]propyl]-4-hydroxybenzamide.
| Compound Name | N-[3-[4-[3-(3-aminopropylamino)propylamino]butylamino]propyl]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 101205073 |
| Molecular Formula | C20H37N5O2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.29 |
| IUPAC Name | N-[3-[4-[3-(3-aminopropylamino)propylamino]butylamino]propyl]-4-hydroxybenzamide |
| SMILES | NCCCNCCCNCCCCNCCCNC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H37N5O2/c21-10-3-13-24-15-4-14-22-11-1-2-12-23-16-5-17-25-20(27)18-6-8-19(26)9-7-18/h6-9,22-24,26H,1-5,10-17,21H2,(H,25,27) |
| InChIKey | GSNQJYZAWCRRJU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|