7-[(4-hydroxybenzoyl)amino]heptanoic acid

C14H19NO4 — CID 24691793

IUPAC7-[(4-hydroxybenzoyl)amino]heptanoic acid
SMILESO=C(O)CCCCCCNC(=O)c1ccc(O)cc1
InChIInChI=1S/C14H19NO4/c16-12-8-6-11(7-9-12)14(19)15-10-4-2-1-3-5-13(17)18/h6-9,16H,1-5,10H2,(H,15,19)(H,17,18)
InChIKeyLEFAIXSLVVSNOX-UHFFFAOYSA-N
MW265.31 g/mol
LogP2.16
Rot. Bonds8

About 7-[(4-hydroxybenzoyl)amino]heptanoic acid

7-[(4-hydroxybenzoyl)amino]heptanoic acid (PubChem CID 24691793) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 7-[(4-hydroxybenzoyl)amino]heptanoic acid.

Molecular Properties

Compound Name7-[(4-hydroxybenzoyl)amino]heptanoic acid
PubChem CID24691793
Molecular FormulaC14H19NO4
Molecular Weight265.31 g/mol
Exact Mass265.13
IUPAC Name7-[(4-hydroxybenzoyl)amino]heptanoic acid
SMILESO=C(O)CCCCCCNC(=O)c1ccc(O)cc1
InChIInChI=1S/C14H19NO4/c16-12-8-6-11(7-9-12)14(19)15-10-4-2-1-3-5-13(17)18/h6-9,16H,1-5,10H2,(H,15,19)(H,17,18)
InChIKeyLEFAIXSLVVSNOX-UHFFFAOYSA-N
XLogP2.16
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.31
LogP ≤ 52.16
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 7-[(4-hydroxybenzoyl)amino]heptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

7-[(4-methylbenzoyl)amino]heptanoic acid
CID 24695278
7-[(4-carbamoylbenzoyl)amino]heptanoic acid
CID 43358997
5-[(4-acetylbenzoyl)amino]pentanoic acid
CID 119234275
7-[[4-(dimethylcarbamoyl)benzoyl]amino]heptanoic acid
CID 119350798
6-[[3,5-bis(5-carboxypentylcarbamoyl)benzoyl]amino]hexanoic acid
CID 71378278
N-(5-aminopentyl)-4-hydroxybenzamide
CID 11459592
N-decyl-4-hydroxybenzamide
CID 15277871
4-(3-carboxypropylcarbamoyl)benzoic acid
CID 119112063
5-[(4-ethylbenzoyl)amino]pentanoic acid
CID 62034291
5-[(3,4-dihydroxybenzoyl)amino]pentanoic acid
CID 107728107
ethyl 6-[(4-hydroxybenzoyl)amino]hexanoate
CID 23657410
5-[[4-(methylsulfanylmethyl)benzoyl]amino]pentanoic acid
CID 62033572

Frequently Asked Questions

What is the IUPAC name of 7-[(4-hydroxybenzoyl)amino]heptanoic acid?
The IUPAC name of 7-[(4-hydroxybenzoyl)amino]heptanoic acid (CID 24691793) is 7-[(4-hydroxybenzoyl)amino]heptanoic acid.
What is the SMILES notation for 7-[(4-hydroxybenzoyl)amino]heptanoic acid?
The canonical SMILES for 7-[(4-hydroxybenzoyl)amino]heptanoic acid is O=C(O)CCCCCCNC(=O)c1ccc(O)cc1.
What is the InChIKey of 7-[(4-hydroxybenzoyl)amino]heptanoic acid?
The InChIKey is LEFAIXSLVVSNOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO4/c16-12-8-6-11(7-9-12)14(19)15-10-4-2-1-3-5-13(17)18/h6-9,16H,1-5,10H2,(H,15,19)(H,17,18).
What are the key properties of 7-[(4-hydroxybenzoyl)amino]heptanoic acid?
7-[(4-hydroxybenzoyl)amino]heptanoic acid has a molecular weight of 265.31 g/mol, XLogP of 2.16, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(4-hydroxybenzoyl)amino]heptanoic acid is sourced from PubChem (CID 24691793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).