C14H19NO3S — CID 62033572
5-[[4-(methylsulfanylmethyl)benzoyl]amino]pentanoic acid (PubChem CID 62033572) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 5-[[4-(methylsulfanylmethyl)benzoyl]amino]pentanoic acid.
| Compound Name | 5-[[4-(methylsulfanylmethyl)benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 62033572 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 5-[[4-(methylsulfanylmethyl)benzoyl]amino]pentanoic acid |
| SMILES | CSCc1ccc(C(=O)NCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C14H19NO3S/c1-19-10-11-5-7-12(8-6-11)14(18)15-9-3-2-4-13(16)17/h5-8H,2-4,9-10H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | YKKXYYZDPNUOHY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|