C27H39N3O9 — CID 71378278
6-[[3,5-bis(5-carboxypentylcarbamoyl)benzoyl]amino]hexanoic acid (PubChem CID 71378278) has the molecular formula C27H39N3O9 and a molecular weight of 549.62 g/mol. Its IUPAC name is 6-[[3,5-bis(5-carboxypentylcarbamoyl)benzoyl]amino]hexanoic acid.
| Compound Name | 6-[[3,5-bis(5-carboxypentylcarbamoyl)benzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 71378278 |
| Molecular Formula | C27H39N3O9 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | 6-[[3,5-bis(5-carboxypentylcarbamoyl)benzoyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)c1cc(C(=O)NCCCCCC(=O)O)cc(C(=O)NCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C27H39N3O9/c31-22(32)10-4-1-7-13-28-25(37)19-16-20(26(38)29-14-8-2-5-11-23(33)34)18-21(17-19)27(39)30-15-9-3-6-12-24(35)36/h16-18H,1-15H2,(H,28,37)(H,29,38)(H,30,39)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | HXSNLGCKVHRRHS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 199.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|