C18H27NO6 — CID 22040273
8-[(3,4,5-trimethoxybenzoyl)amino]octanoic acid (PubChem CID 22040273) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is 8-[(3,4,5-trimethoxybenzoyl)amino]octanoic acid.
| Compound Name | 8-[(3,4,5-trimethoxybenzoyl)amino]octanoic acid |
|---|---|
| PubChem CID | 22040273 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 8-[(3,4,5-trimethoxybenzoyl)amino]octanoic acid |
| SMILES | COc1cc(C(=O)NCCCCCCCC(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C18H27NO6/c1-23-14-11-13(12-15(24-2)17(14)25-3)18(22)19-10-8-6-4-5-7-9-16(20)21/h11-12H,4-10H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | QTYDYWNEMMGRBC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|