C20H25NO6 — CID 110181550
6-[(5,6,7-trimethoxynaphthalene-2-carbonyl)amino]hexanoic acid (PubChem CID 110181550) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is 6-[(5,6,7-trimethoxynaphthalene-2-carbonyl)amino]hexanoic acid.
| Compound Name | 6-[(5,6,7-trimethoxynaphthalene-2-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 110181550 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 6-[(5,6,7-trimethoxynaphthalene-2-carbonyl)amino]hexanoic acid |
| SMILES | COc1cc2cc(C(=O)NCCCCCC(=O)O)ccc2c(OC)c1OC |
| InChI | InChI=1S/C20H25NO6/c1-25-16-12-14-11-13(8-9-15(14)18(26-2)19(16)27-3)20(24)21-10-6-4-5-7-17(22)23/h8-9,11-12H,4-7,10H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | LHZXCMZVQOQVNJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|