5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid

C14H18ClNO5 — CID 62032676

IUPAC5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid
SMILESCOc1cc(C(=O)NCCCCC(=O)O)cc(Cl)c1OC
InChIInChI=1S/C14H18ClNO5/c1-20-11-8-9(7-10(15)13(11)21-2)14(19)16-6-4-3-5-12(17)18/h7-8H,3-6H2,1-2H3,(H,16,19)(H,17,18)
InChIKeyFXVUZPDCZZMHNT-UHFFFAOYSA-N
MW315.75 g/mol
LogP2.34
Rot. Bonds8

About 5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid

5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid (PubChem CID 62032676) has the molecular formula C14H18ClNO5 and a molecular weight of 315.75 g/mol. Its IUPAC name is 5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid.

Molecular Properties

Compound Name5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid
PubChem CID62032676
Molecular FormulaC14H18ClNO5
Molecular Weight315.75 g/mol
Exact Mass315.09
IUPAC Name5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid
SMILESCOc1cc(C(=O)NCCCCC(=O)O)cc(Cl)c1OC
InChIInChI=1S/C14H18ClNO5/c1-20-11-8-9(7-10(15)13(11)21-2)14(19)16-6-4-3-5-12(17)18/h7-8H,3-6H2,1-2H3,(H,16,19)(H,17,18)
InChIKeyFXVUZPDCZZMHNT-UHFFFAOYSA-N
XLogP2.34
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500315.75
LogP ≤ 52.34
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid?
The IUPAC name of 5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid (CID 62032676) is 5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid.
What is the SMILES notation for 5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid?
The canonical SMILES for 5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid is COc1cc(C(=O)NCCCCC(=O)O)cc(Cl)c1OC.
What is the InChIKey of 5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid?
The InChIKey is FXVUZPDCZZMHNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClNO5/c1-20-11-8-9(7-10(15)13(11)21-2)14(19)16-6-4-3-5-12(17)18/h7-8H,3-6H2,1-2H3,(H,16,19)(H,17,18).
What are the key properties of 5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid?
5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid has a molecular weight of 315.75 g/mol, XLogP of 2.34, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid is sourced from PubChem (CID 62032676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).