C14H18ClNO5 — CID 62032676
5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid (PubChem CID 62032676) has the molecular formula C14H18ClNO5 and a molecular weight of 315.75 g/mol. Its IUPAC name is 5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid.
| Compound Name | 5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 62032676 |
| Molecular Formula | C14H18ClNO5 |
| Molecular Weight | 315.75 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 5-[(3-chloro-4,5-dimethoxybenzoyl)amino]pentanoic acid |
| SMILES | COc1cc(C(=O)NCCCCC(=O)O)cc(Cl)c1OC |
| InChI | InChI=1S/C14H18ClNO5/c1-20-11-8-9(7-10(15)13(11)21-2)14(19)16-6-4-3-5-12(17)18/h7-8H,3-6H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | FXVUZPDCZZMHNT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.75 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|