C14H20N2O5 — CID 5235271
N-(4-amino-4-oxobutyl)-3,4,5-trimethoxybenzamide (PubChem CID 5235271) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(4-amino-4-oxobutyl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 5235271 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCCC(N)=O)cc(OC)c1OC |
| InChI | InChI=1S/C14H20N2O5/c1-19-10-7-9(8-11(20-2)13(10)21-3)14(18)16-6-4-5-12(15)17/h7-8H,4-6H2,1-3H3,(H2,15,17)(H,16,18) |
| InChIKey | ZTUYPSUVNBRRMK-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|