C17H25NO6 — CID 3092235
propan-2-yl 4-[(3,4,5-trimethoxybenzoyl)amino]butanoate (PubChem CID 3092235) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is propan-2-yl 4-[(3,4,5-trimethoxybenzoyl)amino]butanoate.
| Compound Name | propan-2-yl 4-[(3,4,5-trimethoxybenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 3092235 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | propan-2-yl 4-[(3,4,5-trimethoxybenzoyl)amino]butanoate |
| SMILES | COc1cc(C(=O)NCCCC(=O)OC(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C17H25NO6/c1-11(2)24-15(19)7-6-8-18-17(20)12-9-13(21-3)16(23-5)14(10-12)22-4/h9-11H,6-8H2,1-5H3,(H,18,20) |
| InChIKey | CVLCGJLBUIGYMZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|