C17H26N2O6 — CID 108570771
2-methylpropyl N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]carbamate (PubChem CID 108570771) has the molecular formula C17H26N2O6 and a molecular weight of 354.40 g/mol. Its IUPAC name is 2-methylpropyl N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]carbamate.
| Compound Name | 2-methylpropyl N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108570771 |
| Molecular Formula | C17H26N2O6 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-methylpropyl N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]carbamate |
| SMILES | COc1cc(C(=O)NCCNC(=O)OCC(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C17H26N2O6/c1-11(2)10-25-17(21)19-7-6-18-16(20)12-8-13(22-3)15(24-5)14(9-12)23-4/h8-9,11H,6-7,10H2,1-5H3,(H,18,20)(H,19,21) |
| InChIKey | QQSQYYKJRAMFPY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|