C18H26N2O4 — CID 39186918
6-[[4-[(2-methylpropanoylamino)methyl]benzoyl]amino]hexanoic acid (PubChem CID 39186918) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 6-[[4-[(2-methylpropanoylamino)methyl]benzoyl]amino]hexanoic acid.
| Compound Name | 6-[[4-[(2-methylpropanoylamino)methyl]benzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 39186918 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 6-[[4-[(2-methylpropanoylamino)methyl]benzoyl]amino]hexanoic acid |
| SMILES | CC(C)C(=O)NCc1ccc(C(=O)NCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C18H26N2O4/c1-13(2)17(23)20-12-14-7-9-15(10-8-14)18(24)19-11-5-3-4-6-16(21)22/h7-10,13H,3-6,11-12H2,1-2H3,(H,19,24)(H,20,23)(H,21,22) |
| InChIKey | SERAFOTVRFMONO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|