C13H21N3O3 — CID 45479385
N-[3-(3-aminopropylamino)propyl]-2,3-dihydroxybenzamide (PubChem CID 45479385) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-[3-(3-aminopropylamino)propyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[3-(3-aminopropylamino)propyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 45479385 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-[3-(3-aminopropylamino)propyl]-2,3-dihydroxybenzamide |
| SMILES | NCCCNCCCNC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C13H21N3O3/c14-6-2-7-15-8-3-9-16-13(19)10-4-1-5-11(17)12(10)18/h1,4-5,15,17-18H,2-3,6-9,14H2,(H,16,19) |
| InChIKey | OJLWBCJWELTRCV-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|