C11H16N2O4 — CID 114345378
N-[2-(2-aminoethoxy)ethyl]-2,3-dihydroxybenzamide (PubChem CID 114345378) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114345378 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-2,3-dihydroxybenzamide |
| SMILES | NCCOCCNC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C11H16N2O4/c12-4-6-17-7-5-13-11(16)8-2-1-3-9(14)10(8)15/h1-3,14-15H,4-7,12H2,(H,13,16) |
| InChIKey | TZTQDGQVKNLKIL-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|