C12H18N4O3 — CID 12964331
1-N,3-N-bis(2-aminoethyl)-2-hydroxybenzene-1,3-dicarboxamide (PubChem CID 12964331) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1-N,3-N-bis(2-aminoethyl)-2-hydroxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2-aminoethyl)-2-hydroxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 12964331 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1-N,3-N-bis(2-aminoethyl)-2-hydroxybenzene-1,3-dicarboxamide |
| SMILES | NCCNC(=O)c1cccc(C(=O)NCCN)c1O |
| InChI | InChI=1S/C12H18N4O3/c13-4-6-15-11(18)8-2-1-3-9(10(8)17)12(19)16-7-5-14/h1-3,17H,4-7,13-14H2,(H,15,18)(H,16,19) |
| InChIKey | YQFOOUHVXMSTQA-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |