C11H12N2OS — CID 53397320
N-(2-aminoethyl)-1-benzothiophene-4-carboxamide (PubChem CID 53397320) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-benzothiophene-4-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-benzothiophene-4-carboxamide |
|---|---|
| PubChem CID | 53397320 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | N-(2-aminoethyl)-1-benzothiophene-4-carboxamide |
| SMILES | NCCNC(=O)c1cccc2sccc12 |
| InChI | InChI=1S/C11H12N2OS/c12-5-6-13-11(14)9-2-1-3-10-8(9)4-7-15-10/h1-4,7H,5-6,12H2,(H,13,14) |
| InChIKey | FKIGFZGXDSYEOD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |