About CID 89318726
CID 89318726 (PubChem CID 89318726) has the molecular formula C10H7BOS
and a molecular weight of 186.04 g/mol.
Molecular Properties
| Compound Name | CID 89318726 |
| PubChem CID | 89318726 |
| Molecular Formula | C10H7BOS |
| Molecular Weight | 186.04 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | — |
| SMILES | [B]CC(=O)c1cccc2sccc12 |
| InChI | InChI=1S/C10H7BOS/c11-6-9(12)7-2-1-3-10-8(7)4-5-13-10/h1-5H,6H2 |
| InChIKey | HXHDRAMCMZIILS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.04 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89318726 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89318726?
The IUPAC name of CID 89318726 (CID 89318726) is not available.
What is the SMILES notation for CID 89318726?
The canonical SMILES for CID 89318726 is [B]CC(=O)c1cccc2sccc12.
What is the InChIKey of CID 89318726?
The InChIKey is HXHDRAMCMZIILS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BOS/c11-6-9(12)7-2-1-3-10-8(7)4-5-13-10/h1-5H,6H2.
What are the key properties of CID 89318726?
CID 89318726 has a molecular weight of 186.04 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89318726 is sourced from PubChem (CID 89318726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).