C15H10FNO2S — CID 115912066
5-[2-(3-fluorophenyl)-2-oxoethyl]thieno[3,2-c]pyridin-4-one (PubChem CID 115912066) has the molecular formula C15H10FNO2S and a molecular weight of 287.32 g/mol. Its IUPAC name is 5-[2-(3-fluorophenyl)-2-oxoethyl]thieno[3,2-c]pyridin-4-one.
| Compound Name | 5-[2-(3-fluorophenyl)-2-oxoethyl]thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 115912066 |
| Molecular Formula | C15H10FNO2S |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 5-[2-(3-fluorophenyl)-2-oxoethyl]thieno[3,2-c]pyridin-4-one |
| SMILES | O=C(Cn1ccc2sccc2c1=O)c1cccc(F)c1 |
| InChI | InChI=1S/C15H10FNO2S/c16-11-3-1-2-10(8-11)13(18)9-17-6-4-14-12(15(17)19)5-7-20-14/h1-8H,9H2 |
| InChIKey | XXYSFNJBAISXKT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |