C12H15NO2S — CID 112557081
5-(5-hydroxypentyl)thieno[3,2-c]pyridin-4-one (PubChem CID 112557081) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 5-(5-hydroxypentyl)thieno[3,2-c]pyridin-4-one.
| Compound Name | 5-(5-hydroxypentyl)thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 112557081 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 5-(5-hydroxypentyl)thieno[3,2-c]pyridin-4-one |
| SMILES | O=c1c2ccsc2ccn1CCCCCO |
| InChI | InChI=1S/C12H15NO2S/c14-8-3-1-2-6-13-7-4-11-10(12(13)15)5-9-16-11/h4-5,7,9,14H,1-3,6,8H2 |
| InChIKey | NVIVMTUJXKZKDB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|