C14H21N3OS — CID 112557134
5-[2-[3-(dimethylamino)propylamino]ethyl]thieno[3,2-c]pyridin-4-one (PubChem CID 112557134) has the molecular formula C14H21N3OS and a molecular weight of 279.41 g/mol. Its IUPAC name is 5-[2-[3-(dimethylamino)propylamino]ethyl]thieno[3,2-c]pyridin-4-one.
| Compound Name | 5-[2-[3-(dimethylamino)propylamino]ethyl]thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 112557134 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 5-[2-[3-(dimethylamino)propylamino]ethyl]thieno[3,2-c]pyridin-4-one |
| SMILES | CN(C)CCCNCCn1ccc2sccc2c1=O |
| InChI | InChI=1S/C14H21N3OS/c1-16(2)8-3-6-15-7-10-17-9-4-13-12(14(17)18)5-11-19-13/h4-5,9,11,15H,3,6-8,10H2,1-2H3 |
| InChIKey | WYHQOKSMTWDEAR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|