C11H9NOS — CID 115886548
5-but-2-ynylthieno[3,2-c]pyridin-4-one (PubChem CID 115886548) has the molecular formula C11H9NOS and a molecular weight of 203.27 g/mol. Its IUPAC name is 5-but-2-ynylthieno[3,2-c]pyridin-4-one.
| Compound Name | 5-but-2-ynylthieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 115886548 |
| Molecular Formula | C11H9NOS |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 5-but-2-ynylthieno[3,2-c]pyridin-4-one |
| SMILES | CC#CCn1ccc2sccc2c1=O |
| InChI | InChI=1S/C11H9NOS/c1-2-3-6-12-7-4-10-9(11(12)13)5-8-14-10/h4-5,7-8H,6H2,1H3 |
| InChIKey | GCQBNGJNZVVGLW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|