C11H11NOS — CID 116626889
5-[(E)-but-2-enyl]thieno[3,2-c]pyridin-4-one (PubChem CID 116626889) has the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. Its IUPAC name is 5-[(E)-but-2-enyl]thieno[3,2-c]pyridin-4-one.
| Compound Name | 5-[(E)-but-2-enyl]thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 116626889 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 5-[(E)-but-2-enyl]thieno[3,2-c]pyridin-4-one |
| SMILES | C/C=C/Cn1ccc2sccc2c1=O |
| InChI | InChI=1S/C11H11NOS/c1-2-3-6-12-7-4-10-9(11(12)13)5-8-14-10/h2-5,7-8H,6H2,1H3/b3-2+ |
| InChIKey | MUROUKLIHODQSS-NSCUHMNNSA-N |
| XLogP | 2.64 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|