C14H10BrNOS — CID 113347683
5-[(4-bromophenyl)methyl]thieno[3,2-c]pyridin-4-one (PubChem CID 113347683) has the molecular formula C14H10BrNOS and a molecular weight of 320.21 g/mol. Its IUPAC name is 5-[(4-bromophenyl)methyl]thieno[3,2-c]pyridin-4-one.
| Compound Name | 5-[(4-bromophenyl)methyl]thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 113347683 |
| Molecular Formula | C14H10BrNOS |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | 5-[(4-bromophenyl)methyl]thieno[3,2-c]pyridin-4-one |
| SMILES | O=c1c2ccsc2ccn1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H10BrNOS/c15-11-3-1-10(2-4-11)9-16-7-5-13-12(14(16)17)6-8-18-13/h1-8H,9H2 |
| InChIKey | DMNSKSPDCWPKEY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |