C14H9FN2O3S — CID 116626859
5-[(3-fluoro-5-nitrophenyl)methyl]thieno[3,2-c]pyridin-4-one (PubChem CID 116626859) has the molecular formula C14H9FN2O3S and a molecular weight of 304.30 g/mol. Its IUPAC name is 5-[(3-fluoro-5-nitrophenyl)methyl]thieno[3,2-c]pyridin-4-one.
| Compound Name | 5-[(3-fluoro-5-nitrophenyl)methyl]thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 116626859 |
| Molecular Formula | C14H9FN2O3S |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 5-[(3-fluoro-5-nitrophenyl)methyl]thieno[3,2-c]pyridin-4-one |
| SMILES | O=c1c2ccsc2ccn1Cc1cc(F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H9FN2O3S/c15-10-5-9(6-11(7-10)17(19)20)8-16-3-1-13-12(14(16)18)2-4-21-13/h1-7H,8H2 |
| InChIKey | OOORZPJCPBNHIK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 65.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|