C9H9NOS — CID 115886528
5-ethylthieno[3,2-c]pyridin-4-one (PubChem CID 115886528) has the molecular formula C9H9NOS and a molecular weight of 179.24 g/mol. Its IUPAC name is 5-ethylthieno[3,2-c]pyridin-4-one.
| Compound Name | 5-ethylthieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 115886528 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 5-ethylthieno[3,2-c]pyridin-4-one |
| SMILES | CCn1ccc2sccc2c1=O |
| InChI | InChI=1S/C9H9NOS/c1-2-10-5-3-8-7(9(10)11)4-6-12-8/h3-6H,2H2,1H3 |
| InChIKey | VEESGDFEFCOMEY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |