C10H11NO2S — CID 104599398
5-(ethoxymethyl)thieno[3,2-c]pyridin-4-one (PubChem CID 104599398) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 5-(ethoxymethyl)thieno[3,2-c]pyridin-4-one.
| Compound Name | 5-(ethoxymethyl)thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 104599398 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 5-(ethoxymethyl)thieno[3,2-c]pyridin-4-one |
| SMILES | CCOCn1ccc2sccc2c1=O |
| InChI | InChI=1S/C10H11NO2S/c1-2-13-7-11-5-3-9-8(10(11)12)4-6-14-9/h3-6H,2,7H2,1H3 |
| InChIKey | NLVJIXGTQCRMTJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |