C14H18BrNOS — CID 112557005
5-[2-(bromomethyl)-3,3-dimethylbutyl]thieno[3,2-c]pyridin-4-one (PubChem CID 112557005) has the molecular formula C14H18BrNOS and a molecular weight of 328.28 g/mol. Its IUPAC name is 5-[2-(bromomethyl)-3,3-dimethylbutyl]thieno[3,2-c]pyridin-4-one.
| Compound Name | 5-[2-(bromomethyl)-3,3-dimethylbutyl]thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 112557005 |
| Molecular Formula | C14H18BrNOS |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 5-[2-(bromomethyl)-3,3-dimethylbutyl]thieno[3,2-c]pyridin-4-one |
| SMILES | CC(C)(C)C(CBr)Cn1ccc2sccc2c1=O |
| InChI | InChI=1S/C14H18BrNOS/c1-14(2,3)10(8-15)9-16-6-4-12-11(13(16)17)5-7-18-12/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | IENYSKNJTPGCLQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|