C12H15NO3S2 — CID 106731694
5-(2-propan-2-ylsulfonylethyl)thieno[3,2-c]pyridin-4-one (PubChem CID 106731694) has the molecular formula C12H15NO3S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 5-(2-propan-2-ylsulfonylethyl)thieno[3,2-c]pyridin-4-one.
| Compound Name | 5-(2-propan-2-ylsulfonylethyl)thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 106731694 |
| Molecular Formula | C12H15NO3S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 5-(2-propan-2-ylsulfonylethyl)thieno[3,2-c]pyridin-4-one |
| SMILES | CC(C)S(=O)(=O)CCn1ccc2sccc2c1=O |
| InChI | InChI=1S/C12H15NO3S2/c1-9(2)18(15,16)8-6-13-5-3-11-10(12(13)14)4-7-17-11/h3-5,7,9H,6,8H2,1-2H3 |
| InChIKey | MDJIQVRLLJFCAM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |