C15H16N2OS2 — CID 115912125
5-[2-(1-thiophen-2-ylethylamino)ethyl]thieno[3,2-c]pyridin-4-one (PubChem CID 115912125) has the molecular formula C15H16N2OS2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 5-[2-(1-thiophen-2-ylethylamino)ethyl]thieno[3,2-c]pyridin-4-one.
| Compound Name | 5-[2-(1-thiophen-2-ylethylamino)ethyl]thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 115912125 |
| Molecular Formula | C15H16N2OS2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 5-[2-(1-thiophen-2-ylethylamino)ethyl]thieno[3,2-c]pyridin-4-one |
| SMILES | CC(NCCn1ccc2sccc2c1=O)c1cccs1 |
| InChI | InChI=1S/C15H16N2OS2/c1-11(13-3-2-9-19-13)16-6-8-17-7-4-14-12(15(17)18)5-10-20-14/h2-5,7,9-11,16H,6,8H2,1H3 |
| InChIKey | CEJMSEXGAWHRKF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |