C14H15F3N2OS — CID 63279959
1-[2-(1-thiophen-2-ylethylamino)ethyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 63279959) has the molecular formula C14H15F3N2OS and a molecular weight of 316.35 g/mol. Its IUPAC name is 1-[2-(1-thiophen-2-ylethylamino)ethyl]-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[2-(1-thiophen-2-ylethylamino)ethyl]-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 63279959 |
| Molecular Formula | C14H15F3N2OS |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 1-[2-(1-thiophen-2-ylethylamino)ethyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | CC(NCCn1cc(C(F)(F)F)ccc1=O)c1cccs1 |
| InChI | InChI=1S/C14H15F3N2OS/c1-10(12-3-2-8-21-12)18-6-7-19-9-11(14(15,16)17)4-5-13(19)20/h2-5,8-10,18H,6-7H2,1H3 |
| InChIKey | JZKAZHGUSZNVNO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |