C9H12F3NS2 — CID 104891288
(1S)-1-thiophen-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]ethanamine (PubChem CID 104891288) has the molecular formula C9H12F3NS2 and a molecular weight of 255.33 g/mol. Its IUPAC name is (1S)-1-thiophen-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]ethanamine.
| Compound Name | (1S)-1-thiophen-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]ethanamine |
|---|---|
| PubChem CID | 104891288 |
| Molecular Formula | C9H12F3NS2 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | (1S)-1-thiophen-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]ethanamine |
| SMILES | C[C@H](NCCSC(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C9H12F3NS2/c1-7(8-3-2-5-14-8)13-4-6-15-9(10,11)12/h2-3,5,7,13H,4,6H2,1H3/t7-/m0/s1 |
| InChIKey | XXIDWFQNXUPZFY-ZETCQYMHSA-N |
| XLogP | 3.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|