C14H14F3NS2 — CID 29045722
(1R)-1-thiophen-2-yl-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]ethanamine (PubChem CID 29045722) has the molecular formula C14H14F3NS2 and a molecular weight of 317.40 g/mol. Its IUPAC name is (1R)-1-thiophen-2-yl-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]ethanamine.
| Compound Name | (1R)-1-thiophen-2-yl-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 29045722 |
| Molecular Formula | C14H14F3NS2 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | (1R)-1-thiophen-2-yl-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]ethanamine |
| SMILES | C[C@@H](NCc1ccc(SC(F)(F)F)cc1)c1cccs1 |
| InChI | InChI=1S/C14H14F3NS2/c1-10(13-3-2-8-19-13)18-9-11-4-6-12(7-5-11)20-14(15,16)17/h2-8,10,18H,9H2,1H3/t10-/m1/s1 |
| InChIKey | WGVIFBYIYJNSPK-SNVBAGLBSA-N |
| XLogP | 5.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |