C13H13Cl2NS — CID 28683372
(1S)-N-[(3,4-dichlorophenyl)methyl]-1-thiophen-2-ylethanamine (PubChem CID 28683372) has the molecular formula C13H13Cl2NS and a molecular weight of 286.23 g/mol. Its IUPAC name is (1S)-N-[(3,4-dichlorophenyl)methyl]-1-thiophen-2-ylethanamine.
| Compound Name | (1S)-N-[(3,4-dichlorophenyl)methyl]-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 28683372 |
| Molecular Formula | C13H13Cl2NS |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | (1S)-N-[(3,4-dichlorophenyl)methyl]-1-thiophen-2-ylethanamine |
| SMILES | C[C@H](NCc1ccc(Cl)c(Cl)c1)c1cccs1 |
| InChI | InChI=1S/C13H13Cl2NS/c1-9(13-3-2-6-17-13)16-8-10-4-5-11(14)12(15)7-10/h2-7,9,16H,8H2,1H3/t9-/m0/s1 |
| InChIKey | MSKHVUSFQMKOMG-VIFPVBQESA-N |
| XLogP | 4.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |