C15H17NOS — CID 81398895
(1S)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-thiophen-2-ylethanamine (PubChem CID 81398895) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is (1S)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-thiophen-2-ylethanamine.
| Compound Name | (1S)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 81398895 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | (1S)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-thiophen-2-ylethanamine |
| SMILES | C[C@H](NCc1ccc2c(c1)CCO2)c1cccs1 |
| InChI | InChI=1S/C15H17NOS/c1-11(15-3-2-8-18-15)16-10-12-4-5-14-13(9-12)6-7-17-14/h2-5,8-9,11,16H,6-7,10H2,1H3/t11-/m0/s1 |
| InChIKey | GKQAYSFTGURXQK-NSHDSACASA-N |
| XLogP | 3.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|