C19H23NO3 — CID 94531089
(1R)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-(3,4-dimethoxyphenyl)ethanamine (PubChem CID 94531089) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (1R)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-(3,4-dimethoxyphenyl)ethanamine.
| Compound Name | (1R)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-(3,4-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 94531089 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (1R)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-(3,4-dimethoxyphenyl)ethanamine |
| SMILES | COc1ccc([C@@H](C)NCc2ccc3c(c2)CCO3)cc1OC |
| InChI | InChI=1S/C19H23NO3/c1-13(15-5-7-18(21-2)19(11-15)22-3)20-12-14-4-6-17-16(10-14)8-9-23-17/h4-7,10-11,13,20H,8-9,12H2,1-3H3/t13-/m1/s1 |
| InChIKey | OILPWNLWYOXGHS-CYBMUJFWSA-N |
| XLogP | 3.49 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|