C12H17NO2 — CID 93297893
(2S)-2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)propan-1-ol (PubChem CID 93297893) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (2S)-2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)propan-1-ol.
| Compound Name | (2S)-2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)propan-1-ol |
|---|---|
| PubChem CID | 93297893 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (2S)-2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)propan-1-ol |
| SMILES | C[C@@H](CO)NCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C12H17NO2/c1-9(8-14)13-7-10-2-3-12-11(6-10)4-5-15-12/h2-3,6,9,13-14H,4-5,7-8H2,1H3/t9-/m0/s1 |
| InChIKey | ZPBWOKDMTZENQZ-VIFPVBQESA-N |
| XLogP | 1.09 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|