C18H21NO2 — CID 104922890
(2R)-2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-3-phenylpropan-1-ol (PubChem CID 104922890) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (2R)-2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-3-phenylpropan-1-ol.
| Compound Name | (2R)-2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 104922890 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (2R)-2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-3-phenylpropan-1-ol |
| SMILES | OC[C@@H](Cc1ccccc1)NCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C18H21NO2/c20-13-17(11-14-4-2-1-3-5-14)19-12-15-6-7-18-16(10-15)8-9-21-18/h1-7,10,17,19-20H,8-9,11-13H2/t17-/m1/s1 |
| InChIKey | ASHVQJGFCRPIAP-QGZVFWFLSA-N |
| XLogP | 2.31 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|