C17H18FNO — CID 81365243
(1S)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-(3-fluorophenyl)ethanamine (PubChem CID 81365243) has the molecular formula C17H18FNO and a molecular weight of 271.33 g/mol. Its IUPAC name is (1S)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-(3-fluorophenyl)ethanamine.
| Compound Name | (1S)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-(3-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 81365243 |
| Molecular Formula | C17H18FNO |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (1S)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-(3-fluorophenyl)ethanamine |
| SMILES | C[C@H](NCc1ccc2c(c1)CCO2)c1cccc(F)c1 |
| InChI | InChI=1S/C17H18FNO/c1-12(14-3-2-4-16(18)10-14)19-11-13-5-6-17-15(9-13)7-8-20-17/h2-6,9-10,12,19H,7-8,11H2,1H3/t12-/m0/s1 |
| InChIKey | WDYZQTSUIRRHIR-LBPRGKRZSA-N |
| XLogP | 3.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|