C21H24N2O2 — CID 95149643
1-[3-[(1R)-1-(2,3-dihydro-1-benzofuran-5-ylmethylamino)ethyl]phenyl]pyrrolidin-2-one (PubChem CID 95149643) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-[3-[(1R)-1-(2,3-dihydro-1-benzofuran-5-ylmethylamino)ethyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[(1R)-1-(2,3-dihydro-1-benzofuran-5-ylmethylamino)ethyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 95149643 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1-[3-[(1R)-1-(2,3-dihydro-1-benzofuran-5-ylmethylamino)ethyl]phenyl]pyrrolidin-2-one |
| SMILES | C[C@@H](NCc1ccc2c(c1)CCO2)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C21H24N2O2/c1-15(22-14-16-7-8-20-18(12-16)9-11-25-20)17-4-2-5-19(13-17)23-10-3-6-21(23)24/h2,4-5,7-8,12-13,15,22H,3,6,9-11,14H2,1H3/t15-/m1/s1 |
| InChIKey | NUZLAJJDLPENCZ-OAHLLOKOSA-N |
| XLogP | 3.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|